C30H43N7O7 — CID 155206981
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-[2-nitro-5-[6-(4-octyltriazol-1-yl)hexoxy]phenyl]acetate (PubChem CID 155206981) has the molecular formula C30H43N7O7 and a molecular weight of 613.72 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-[2-nitro-5-[6-(4-octyltriazol-1-yl)hexoxy]phenyl]acetate.
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-[2-nitro-5-[6-(4-octyltriazol-1-yl)hexoxy]phenyl]acetate |
|---|---|
| PubChem CID | 155206981 |
| Molecular Formula | C30H43N7O7 |
| Molecular Weight | 613.72 g/mol |
| Exact Mass | 613.32 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-[2-nitro-5-[6-(4-octyltriazol-1-yl)hexoxy]phenyl]acetate |
| SMILES | CCCCCCCCc1cn(CCCCCCOc2ccc([N+](=O)[O-])c(CC(=O)OCCn3c([N+](=O)[O-])cnc3C)c2)nn1 |
| InChI | InChI=1S/C30H43N7O7/c1-3-4-5-6-7-10-13-26-23-34(33-32-26)16-11-8-9-12-18-43-27-14-15-28(36(39)40)25(20-27)21-30(38)44-19-17-35-24(2)31-22-29(35)37(41)42/h14-15,20,22-23H,3-13,16-19,21H2,1-2H3 |
| InChIKey | HTQXFTASFQCBEW-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 170.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.72 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|