C14H13ClN6O2 — CID 155926378
1-[(3-chlorophenyl)methyl]-4-[(2-methyl-5-nitroimidazol-1-yl)methyl]triazole (PubChem CID 155926378) has the molecular formula C14H13ClN6O2 and a molecular weight of 332.75 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-4-[(2-methyl-5-nitroimidazol-1-yl)methyl]triazole.
| Compound Name | 1-[(3-chlorophenyl)methyl]-4-[(2-methyl-5-nitroimidazol-1-yl)methyl]triazole |
|---|---|
| PubChem CID | 155926378 |
| Molecular Formula | C14H13ClN6O2 |
| Molecular Weight | 332.75 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-4-[(2-methyl-5-nitroimidazol-1-yl)methyl]triazole |
| SMILES | Cc1ncc([N+](=O)[O-])n1Cc1cn(Cc2cccc(Cl)c2)nn1 |
| InChI | InChI=1S/C14H13ClN6O2/c1-10-16-6-14(21(22)23)20(10)9-13-8-19(18-17-13)7-11-3-2-4-12(15)5-11/h2-6,8H,7,9H2,1H3 |
| InChIKey | JBWYUCXETMYMEL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.75 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|