C13H12N2O3 — CID 163203937
6-(cyclobutylmethoxy)phthalazine-1,4-dione (PubChem CID 163203937) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 6-(cyclobutylmethoxy)phthalazine-1,4-dione.
| Compound Name | 6-(cyclobutylmethoxy)phthalazine-1,4-dione |
|---|---|
| PubChem CID | 163203937 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 6-(cyclobutylmethoxy)phthalazine-1,4-dione |
| SMILES | O=C1N=NC(=O)c2cc(OCC3CCC3)ccc21 |
| InChI | InChI=1S/C13H12N2O3/c16-12-10-5-4-9(18-7-8-2-1-3-8)6-11(10)13(17)15-14-12/h4-6,8H,1-3,7H2 |
| InChIKey | NWOORGOMYQAWAE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |