C23H29NO10 — CID 163207545
[(2R,3R,4R,5S)-6-(3-anilino-3-oxopropyl)-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate (PubChem CID 163207545) has the molecular formula C23H29NO10 and a molecular weight of 483.51 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-6-(3-anilino-3-oxopropyl)-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate.
| Compound Name | [(2R,3R,4R,5S)-6-(3-anilino-3-oxopropyl)-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate |
|---|---|
| PubChem CID | 163207545 |
| Molecular Formula | C23H29NO10 |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | [(2R,3R,4R,5S)-6-(3-anilino-3-oxopropyl)-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@H]1OC(CCC(=O)Nc2ccccc2)[C@H](OC(=O)C[2H])[C@@H](OC(=O)C[2H])[C@@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C23H29NO10/c1-13(25)30-12-19-22(32-15(3)27)23(33-16(4)28)21(31-14(2)26)18(34-19)10-11-20(29)24-17-8-6-5-7-9-17/h5-9,18-19,21-23H,10-12H2,1-4H3,(H,24,29)/t18?,19-,21+,22-,23-/m1/s1/i1D,2D,3D,4D |
| InChIKey | PNTIYTLMAZCBLE-MTPCCDFXSA-N |
| XLogP | 1.53 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|