C26H24FN3O3 — CID 163208528
4-[1-(2-fluoroprop-2-enoyl)piperidin-4-yl]-2-(5-phenoxy-2-pyridinyl)benzamide (PubChem CID 163208528) has the molecular formula C26H24FN3O3 and a molecular weight of 445.49 g/mol. Its IUPAC name is 4-[1-(2-fluoroprop-2-enoyl)piperidin-4-yl]-2-(5-phenoxy-2-pyridinyl)benzamide.
| Compound Name | 4-[1-(2-fluoroprop-2-enoyl)piperidin-4-yl]-2-(5-phenoxy-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 163208528 |
| Molecular Formula | C26H24FN3O3 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 4-[1-(2-fluoroprop-2-enoyl)piperidin-4-yl]-2-(5-phenoxy-2-pyridinyl)benzamide |
| SMILES | C=C(F)C(=O)N1CCC(c2ccc(C(N)=O)c(-c3ccc(Oc4ccccc4)cn3)c2)CC1 |
| InChI | InChI=1S/C26H24FN3O3/c1-17(27)26(32)30-13-11-18(12-14-30)19-7-9-22(25(28)31)23(15-19)24-10-8-21(16-29-24)33-20-5-3-2-4-6-20/h2-10,15-16,18H,1,11-14H2,(H2,28,31) |
| InChIKey | HJTFHDFPRRICBE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|