C23H24N4O2 — CID 163208529
4-(4-aminopiperidin-1-yl)-2-(5-phenoxy-2-pyridinyl)benzamide (PubChem CID 163208529) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 4-(4-aminopiperidin-1-yl)-2-(5-phenoxy-2-pyridinyl)benzamide.
| Compound Name | 4-(4-aminopiperidin-1-yl)-2-(5-phenoxy-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 163208529 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 4-(4-aminopiperidin-1-yl)-2-(5-phenoxy-2-pyridinyl)benzamide |
| SMILES | NC(=O)c1ccc(N2CCC(N)CC2)cc1-c1ccc(Oc2ccccc2)cn1 |
| InChI | InChI=1S/C23H24N4O2/c24-16-10-12-27(13-11-16)17-6-8-20(23(25)28)21(14-17)22-9-7-19(15-26-22)29-18-4-2-1-3-5-18/h1-9,14-16H,10-13,24H2,(H2,25,28) |
| InChIKey | IHXIHXHPJHKTAI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |