C24H22N4O3 — CID 146879106
5-[(1-cyanopyrrolidin-3-yl)methyl]-2-(4-phenoxyphenoxy)pyridine-3-carboxamide (PubChem CID 146879106) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 5-[(1-cyanopyrrolidin-3-yl)methyl]-2-(4-phenoxyphenoxy)pyridine-3-carboxamide.
| Compound Name | 5-[(1-cyanopyrrolidin-3-yl)methyl]-2-(4-phenoxyphenoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146879106 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 5-[(1-cyanopyrrolidin-3-yl)methyl]-2-(4-phenoxyphenoxy)pyridine-3-carboxamide |
| SMILES | N#CN1CCC(Cc2cnc(Oc3ccc(Oc4ccccc4)cc3)c(C(N)=O)c2)C1 |
| InChI | InChI=1S/C24H22N4O3/c25-16-28-11-10-17(15-28)12-18-13-22(23(26)29)24(27-14-18)31-21-8-6-20(7-9-21)30-19-4-2-1-3-5-19/h1-9,13-14,17H,10-12,15H2,(H2,26,29) |
| InChIKey | SRLSWQFEIFRJJQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|