C28H28N4O4 — CID 123449393
5-(5-but-2-enoyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-2-(4-phenoxyphenoxy)pyridine-3-carboxamide (PubChem CID 123449393) has the molecular formula C28H28N4O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is 5-(5-but-2-enoyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-2-(4-phenoxyphenoxy)pyridine-3-carboxamide.
| Compound Name | 5-(5-but-2-enoyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-2-(4-phenoxyphenoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123449393 |
| Molecular Formula | C28H28N4O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 5-(5-but-2-enoyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-2-(4-phenoxyphenoxy)pyridine-3-carboxamide |
| SMILES | CC=CC(=O)N1CC2CN(c3cnc(Oc4ccc(Oc5ccccc5)cc4)c(C(N)=O)c3)CC2C1 |
| InChI | InChI=1S/C28H28N4O4/c1-2-6-26(33)32-17-19-15-31(16-20(19)18-32)21-13-25(27(29)34)28(30-14-21)36-24-11-9-23(10-12-24)35-22-7-4-3-5-8-22/h2-14,19-20H,15-18H2,1H3,(H2,29,34) |
| InChIKey | XQXMIUNYJKXHFA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|