C26H26N4O4 — CID 118037796
2-(4-phenoxyphenoxy)-5-[piperidin-4-yl(prop-2-enoyl)amino]pyridine-3-carboxamide (PubChem CID 118037796) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 2-(4-phenoxyphenoxy)-5-[piperidin-4-yl(prop-2-enoyl)amino]pyridine-3-carboxamide.
| Compound Name | 2-(4-phenoxyphenoxy)-5-[piperidin-4-yl(prop-2-enoyl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118037796 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 2-(4-phenoxyphenoxy)-5-[piperidin-4-yl(prop-2-enoyl)amino]pyridine-3-carboxamide |
| SMILES | C=CC(=O)N(c1cnc(Oc2ccc(Oc3ccccc3)cc2)c(C(N)=O)c1)C1CCNCC1 |
| InChI | InChI=1S/C26H26N4O4/c1-2-24(31)30(18-12-14-28-15-13-18)19-16-23(25(27)32)26(29-17-19)34-22-10-8-21(9-11-22)33-20-6-4-3-5-7-20/h2-11,16-18,28H,1,12-15H2,(H2,27,32) |
| InChIKey | FGFUAPWAAJJSLU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|