C12H16N6O2 — CID 118038305
4-amino-2-[prop-2-enoyl(pyrrolidin-3-yl)amino]pyrimidine-5-carboxamide (PubChem CID 118038305) has the molecular formula C12H16N6O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-amino-2-[prop-2-enoyl(pyrrolidin-3-yl)amino]pyrimidine-5-carboxamide.
| Compound Name | 4-amino-2-[prop-2-enoyl(pyrrolidin-3-yl)amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 118038305 |
| Molecular Formula | C12H16N6O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 4-amino-2-[prop-2-enoyl(pyrrolidin-3-yl)amino]pyrimidine-5-carboxamide |
| SMILES | C=CC(=O)N(c1ncc(C(N)=O)c(N)n1)C1CCNC1 |
| InChI | InChI=1S/C12H16N6O2/c1-2-9(19)18(7-3-4-15-5-7)12-16-6-8(11(14)20)10(13)17-12/h2,6-7,15H,1,3-5H2,(H2,14,20)(H2,13,16,17) |
| InChIKey | OJKJXNROEIRKGF-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|