C24H23FN4O5 — CID 118038505
[1-[5-carbamoyl-6-[4-(3-fluorophenoxy)phenoxy]-3-pyridinyl]piperidin-3-yl]carbamic acid (PubChem CID 118038505) has the molecular formula C24H23FN4O5 and a molecular weight of 466.47 g/mol. Its IUPAC name is [1-[5-carbamoyl-6-[4-(3-fluorophenoxy)phenoxy]-3-pyridinyl]piperidin-3-yl]carbamic acid.
| Compound Name | [1-[5-carbamoyl-6-[4-(3-fluorophenoxy)phenoxy]-3-pyridinyl]piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 118038505 |
| Molecular Formula | C24H23FN4O5 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | [1-[5-carbamoyl-6-[4-(3-fluorophenoxy)phenoxy]-3-pyridinyl]piperidin-3-yl]carbamic acid |
| SMILES | NC(=O)c1cc(N2CCCC(NC(=O)O)C2)cnc1Oc1ccc(Oc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C24H23FN4O5/c25-15-3-1-5-20(11-15)33-18-6-8-19(9-7-18)34-23-21(22(26)30)12-17(13-27-23)29-10-2-4-16(14-29)28-24(31)32/h1,3,5-9,11-13,16,28H,2,4,10,14H2,(H2,26,30)(H,31,32) |
| InChIKey | XNHHZTDQQUAPRA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |