C26H25FN4O4 — CID 123773558
5-[3-(but-2-enoylamino)pyrrolidin-1-yl]-2-[4-(3-fluorophenoxy)phenoxy]pyridine-3-carboxamide (PubChem CID 123773558) has the molecular formula C26H25FN4O4 and a molecular weight of 476.51 g/mol. Its IUPAC name is 5-[3-(but-2-enoylamino)pyrrolidin-1-yl]-2-[4-(3-fluorophenoxy)phenoxy]pyridine-3-carboxamide.
| Compound Name | 5-[3-(but-2-enoylamino)pyrrolidin-1-yl]-2-[4-(3-fluorophenoxy)phenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123773558 |
| Molecular Formula | C26H25FN4O4 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 5-[3-(but-2-enoylamino)pyrrolidin-1-yl]-2-[4-(3-fluorophenoxy)phenoxy]pyridine-3-carboxamide |
| SMILES | CC=CC(=O)NC1CCN(c2cnc(Oc3ccc(Oc4cccc(F)c4)cc3)c(C(N)=O)c2)C1 |
| InChI | InChI=1S/C26H25FN4O4/c1-2-4-24(32)30-18-11-12-31(16-18)19-14-23(25(28)33)26(29-15-19)35-21-9-7-20(8-10-21)34-22-6-3-5-17(27)13-22/h2-10,13-15,18H,11-12,16H2,1H3,(H2,28,33)(H,30,32) |
| InChIKey | ZXXIBXLLHWENSV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|