C16H15N5O — CID 163209198
N-[[4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-6-yl)phenyl]methyl]prop-2-enamide (PubChem CID 163209198) has the molecular formula C16H15N5O and a molecular weight of 293.33 g/mol. Its IUPAC name is N-[[4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-6-yl)phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-6-yl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 163209198 |
| Molecular Formula | C16H15N5O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-[[4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-6-yl)phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1ccc(-c2cc3c(N)ncnn3c2)cc1 |
| InChI | InChI=1S/C16H15N5O/c1-2-15(22)18-8-11-3-5-12(6-4-11)13-7-14-16(17)19-10-20-21(14)9-13/h2-7,9-10H,1,8H2,(H,18,22)(H2,17,19,20) |
| InChIKey | YWOYPDBHVUBQTR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|