C27H25N7O — CID 163210192
N-[4-[(3R)-3-[[8-(1H-indol-3-yl)imidazo[1,2-b]pyridazin-6-yl]amino]pyrrolidin-1-yl]phenyl]prop-2-enamide (PubChem CID 163210192) has the molecular formula C27H25N7O and a molecular weight of 463.55 g/mol. Its IUPAC name is N-[4-[(3R)-3-[[8-(1H-indol-3-yl)imidazo[1,2-b]pyridazin-6-yl]amino]pyrrolidin-1-yl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[(3R)-3-[[8-(1H-indol-3-yl)imidazo[1,2-b]pyridazin-6-yl]amino]pyrrolidin-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 163210192 |
| Molecular Formula | C27H25N7O |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | N-[4-[(3R)-3-[[8-(1H-indol-3-yl)imidazo[1,2-b]pyridazin-6-yl]amino]pyrrolidin-1-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(N2CC[C@@H](Nc3cc(-c4c[nH]c5ccccc45)c4nccn4n3)C2)cc1 |
| InChI | InChI=1S/C27H25N7O/c1-2-26(35)31-18-7-9-20(10-8-18)33-13-11-19(17-33)30-25-15-22(27-28-12-14-34(27)32-25)23-16-29-24-6-4-3-5-21(23)24/h2-10,12,14-16,19,29H,1,11,13,17H2,(H,30,32)(H,31,35)/t19-/m1/s1 |
| InChIKey | PBCCICPGMHBBJR-LJQANCHMSA-N |
| XLogP | 4.69 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|