C19H19ClN4O3 — CID 166412459
N-[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]-2-hydroxy-5-(prop-2-enoylamino)benzamide (PubChem CID 166412459) has the molecular formula C19H19ClN4O3 and a molecular weight of 386.84 g/mol. Its IUPAC name is N-[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]-2-hydroxy-5-(prop-2-enoylamino)benzamide.
| Compound Name | N-[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]-2-hydroxy-5-(prop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 166412459 |
| Molecular Formula | C19H19ClN4O3 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N-[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]-2-hydroxy-5-(prop-2-enoylamino)benzamide |
| SMILES | C=CC(=O)Nc1ccc(O)c(C(=O)NC2CCN(c3ncccc3Cl)C2)c1 |
| InChI | InChI=1S/C19H19ClN4O3/c1-2-17(26)22-12-5-6-16(25)14(10-12)19(27)23-13-7-9-24(11-13)18-15(20)4-3-8-21-18/h2-6,8,10,13,25H,1,7,9,11H2,(H,22,26)(H,23,27) |
| InChIKey | HUEHXVZOCHZHEW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|