About 3-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-4-methoxyphenyl]-1-methylnaphthalen-2-ol
3-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-4-methoxyphenyl]-1-methylnaphthalen-2-ol (PubChem CID 163214329) has the molecular formula C32H36O3
and a molecular weight of 468.64 g/mol. Its IUPAC name is 3-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-4-methoxyphenyl]-1-methylnaphthalen-2-ol.
Molecular Properties
| Compound Name | 3-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-4-methoxyphenyl]-1-methylnaphthalen-2-ol |
| PubChem CID | 163214329 |
| Molecular Formula | C32H36O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 3-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-4-methoxyphenyl]-1-methylnaphthalen-2-ol |
| SMILES | COc1ccc(-c2cc3ccccc3c(C)c2O)c(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C32H36O3/c1-19-23-12-10-9-11-20(23)15-26(29(19)33)24-14-13-22(35-8)18-25(24)21-16-27(31(2,3)4)30(34)28(17-21)32(5,6)7/h9-18,33-34H,1-8H3 |
| InChIKey | IJCUJDWTMKZXRG-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-4-methoxyphenyl]-1-methylnaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-4-methoxyphenyl]-1-methylnaphthalen-2-ol?
The IUPAC name of 3-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-4-methoxyphenyl]-1-methylnaphthalen-2-ol (CID 163214329) is 3-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-4-methoxyphenyl]-1-methylnaphthalen-2-ol.
What is the SMILES notation for 3-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-4-methoxyphenyl]-1-methylnaphthalen-2-ol?
The canonical SMILES for 3-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-4-methoxyphenyl]-1-methylnaphthalen-2-ol is COc1ccc(-c2cc3ccccc3c(C)c2O)c(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c1.
What is the InChIKey of 3-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-4-methoxyphenyl]-1-methylnaphthalen-2-ol?
The InChIKey is IJCUJDWTMKZXRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H36O3/c1-19-23-12-10-9-11-20(23)15-26(29(19)33)24-14-13-22(35-8)18-25(24)21-16-27(31(2,3)4)30(34)28(17-21)32(5,6)7/h9-18,33-34H,1-8H3.
What are the key properties of 3-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-4-methoxyphenyl]-1-methylnaphthalen-2-ol?
3-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-4-methoxyphenyl]-1-methylnaphthalen-2-ol has a molecular weight of 468.64 g/mol, XLogP of 8.50, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-4-methoxyphenyl]-1-methylnaphthalen-2-ol is sourced from PubChem (CID 163214329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).