C40H46ClN5O — CID 163215995
3-[4-[4-[2-butyl-1-[4-(4-chlorophenoxy)phenyl]imidazol-4-yl]piperidin-1-yl]butyl]-1-propylindole-5-carbonitrile (PubChem CID 163215995) has the molecular formula C40H46ClN5O and a molecular weight of 648.30 g/mol. Its IUPAC name is 3-[4-[4-[2-butyl-1-[4-(4-chlorophenoxy)phenyl]imidazol-4-yl]piperidin-1-yl]butyl]-1-propylindole-5-carbonitrile.
| Compound Name | 3-[4-[4-[2-butyl-1-[4-(4-chlorophenoxy)phenyl]imidazol-4-yl]piperidin-1-yl]butyl]-1-propylindole-5-carbonitrile |
|---|---|
| PubChem CID | 163215995 |
| Molecular Formula | C40H46ClN5O |
| Molecular Weight | 648.30 g/mol |
| Exact Mass | 647.34 |
| IUPAC Name | 3-[4-[4-[2-butyl-1-[4-(4-chlorophenoxy)phenyl]imidazol-4-yl]piperidin-1-yl]butyl]-1-propylindole-5-carbonitrile |
| SMILES | CCCCc1nc(C2CCN(CCCCc3cn(CCC)c4ccc(C#N)cc34)CC2)cn1-c1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C40H46ClN5O/c1-3-5-9-40-43-38(29-46(40)34-13-17-36(18-14-34)47-35-15-11-33(41)12-16-35)31-20-24-44(25-21-31)23-7-6-8-32-28-45(22-4-2)39-19-10-30(27-42)26-37(32)39/h10-19,26,28-29,31H,3-9,20-25H2,1-2H3 |
| InChIKey | SSPBSCGKKAGMQQ-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 59.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.30 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|