About methyl 2-[4-[[4-(1,3-dioxol-2-yl)-2-methoxyphenoxy]methyl]-3-(trifluoromethyl)phenyl]acetate
methyl 2-[4-[[4-(1,3-dioxol-2-yl)-2-methoxyphenoxy]methyl]-3-(trifluoromethyl)phenyl]acetate (PubChem CID 163216609) has the molecular formula C21H19F3O6
and a molecular weight of 424.37 g/mol. Its IUPAC name is methyl 2-[4-[[4-(1,3-dioxol-2-yl)-2-methoxyphenoxy]methyl]-3-(trifluoromethyl)phenyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[4-[[4-(1,3-dioxol-2-yl)-2-methoxyphenoxy]methyl]-3-(trifluoromethyl)phenyl]acetate |
| PubChem CID | 163216609 |
| Molecular Formula | C21H19F3O6 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | methyl 2-[4-[[4-(1,3-dioxol-2-yl)-2-methoxyphenoxy]methyl]-3-(trifluoromethyl)phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(COc2ccc(C3OC=CO3)cc2OC)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H19F3O6/c1-26-18-11-14(20-28-7-8-29-20)5-6-17(18)30-12-15-4-3-13(10-19(25)27-2)9-16(15)21(22,23)24/h3-9,11,20H,10,12H2,1-2H3 |
| InChIKey | LPKIVBFIPOKUDS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[4-[[4-(1,3-dioxol-2-yl)-2-methoxyphenoxy]methyl]-3-(trifluoromethyl)phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-[[4-(1,3-dioxol-2-yl)-2-methoxyphenoxy]methyl]-3-(trifluoromethyl)phenyl]acetate?
The IUPAC name of methyl 2-[4-[[4-(1,3-dioxol-2-yl)-2-methoxyphenoxy]methyl]-3-(trifluoromethyl)phenyl]acetate (CID 163216609) is methyl 2-[4-[[4-(1,3-dioxol-2-yl)-2-methoxyphenoxy]methyl]-3-(trifluoromethyl)phenyl]acetate.
What is the SMILES notation for methyl 2-[4-[[4-(1,3-dioxol-2-yl)-2-methoxyphenoxy]methyl]-3-(trifluoromethyl)phenyl]acetate?
The canonical SMILES for methyl 2-[4-[[4-(1,3-dioxol-2-yl)-2-methoxyphenoxy]methyl]-3-(trifluoromethyl)phenyl]acetate is COC(=O)Cc1ccc(COc2ccc(C3OC=CO3)cc2OC)c(C(F)(F)F)c1.
What is the InChIKey of methyl 2-[4-[[4-(1,3-dioxol-2-yl)-2-methoxyphenoxy]methyl]-3-(trifluoromethyl)phenyl]acetate?
The InChIKey is LPKIVBFIPOKUDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F3O6/c1-26-18-11-14(20-28-7-8-29-20)5-6-17(18)30-12-15-4-3-13(10-19(25)27-2)9-16(15)21(22,23)24/h3-9,11,20H,10,12H2,1-2H3.
What are the key properties of methyl 2-[4-[[4-(1,3-dioxol-2-yl)-2-methoxyphenoxy]methyl]-3-(trifluoromethyl)phenyl]acetate?
methyl 2-[4-[[4-(1,3-dioxol-2-yl)-2-methoxyphenoxy]methyl]-3-(trifluoromethyl)phenyl]acetate has a molecular weight of 424.37 g/mol, XLogP of 4.53, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-[[4-(1,3-dioxol-2-yl)-2-methoxyphenoxy]methyl]-3-(trifluoromethyl)phenyl]acetate is sourced from PubChem (CID 163216609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).