C26H28N2O3 — CID 163218011
N-[(E)-(2-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylideneamino]-3-methyl-7-propan-2-ylazulene-1-carboxamide (PubChem CID 163218011) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylideneamino]-3-methyl-7-propan-2-ylazulene-1-carboxamide.
| Compound Name | N-[(E)-(2-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylideneamino]-3-methyl-7-propan-2-ylazulene-1-carboxamide |
|---|---|
| PubChem CID | 163218011 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N-[(E)-(2-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylideneamino]-3-methyl-7-propan-2-ylazulene-1-carboxamide |
| SMILES | C=CCc1cc(/C=N/NC(=O)c2cc(C)c3cccc(C(C)C)cc2-3)c(O)c(OC)c1 |
| InChI | InChI=1S/C26H28N2O3/c1-6-8-18-12-20(25(29)24(13-18)31-5)15-27-28-26(30)23-11-17(4)21-10-7-9-19(16(2)3)14-22(21)23/h6-7,9-16,29H,1,8H2,2-5H3,(H,28,30)/b27-15+ |
| InChIKey | RSAKMQDVHLOCBR-JFLMPSFJSA-N |
| XLogP | 5.43 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|