C10H12F2N2O2 — CID 163220387
4,4-difluorobut-3-enyl 2-(2-methylimidazol-1-yl)acetate (PubChem CID 163220387) has the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. Its IUPAC name is 4,4-difluorobut-3-enyl 2-(2-methylimidazol-1-yl)acetate.
| Compound Name | 4,4-difluorobut-3-enyl 2-(2-methylimidazol-1-yl)acetate |
|---|---|
| PubChem CID | 163220387 |
| Molecular Formula | C10H12F2N2O2 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 4,4-difluorobut-3-enyl 2-(2-methylimidazol-1-yl)acetate |
| SMILES | Cc1nccn1CC(=O)OCCC=C(F)F |
| InChI | InChI=1S/C10H12F2N2O2/c1-8-13-4-5-14(8)7-10(15)16-6-2-3-9(11)12/h3-5H,2,6-7H2,1H3 |
| InChIKey | YTVLDMZKNQYNKJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|