C18H14F4N6O — CID 163220841
cyclopropane;N-[6-[6-fluoro-5-(trifluoromethyl)-1H-indazol-4-yl]imidazo[1,2-a]pyrazin-2-yl]formamide (PubChem CID 163220841) has the molecular formula C18H14F4N6O and a molecular weight of 406.34 g/mol. Its IUPAC name is cyclopropane;N-[6-[6-fluoro-5-(trifluoromethyl)-1H-indazol-4-yl]imidazo[1,2-a]pyrazin-2-yl]formamide.
| Compound Name | cyclopropane;N-[6-[6-fluoro-5-(trifluoromethyl)-1H-indazol-4-yl]imidazo[1,2-a]pyrazin-2-yl]formamide |
|---|---|
| PubChem CID | 163220841 |
| Molecular Formula | C18H14F4N6O |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | cyclopropane;N-[6-[6-fluoro-5-(trifluoromethyl)-1H-indazol-4-yl]imidazo[1,2-a]pyrazin-2-yl]formamide |
| SMILES | C1CC1.O=CNc1cn2cc(-c3c(C(F)(F)F)c(F)cc4[nH]ncc34)ncc2n1 |
| InChI | InChI=1S/C15H8F4N6O.C3H6/c16-8-1-9-7(2-22-24-9)13(14(8)15(17,18)19)10-4-25-5-11(21-6-26)23-12(25)3-20-10;1-2-3-1/h1-6H,(H,21,26)(H,22,24);1-3H2 |
| InChIKey | XQKKDGQLNCSXNK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|