C17H11F4N5O — CID 163221060
N-[6-[6-fluoro-5-methyl-7-(trifluoromethyl)-1H-indazol-4-yl]imidazo[1,2-a]pyridin-2-yl]formamide (PubChem CID 163221060) has the molecular formula C17H11F4N5O and a molecular weight of 377.30 g/mol. Its IUPAC name is N-[6-[6-fluoro-5-methyl-7-(trifluoromethyl)-1H-indazol-4-yl]imidazo[1,2-a]pyridin-2-yl]formamide.
| Compound Name | N-[6-[6-fluoro-5-methyl-7-(trifluoromethyl)-1H-indazol-4-yl]imidazo[1,2-a]pyridin-2-yl]formamide |
|---|---|
| PubChem CID | 163221060 |
| Molecular Formula | C17H11F4N5O |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-[6-[6-fluoro-5-methyl-7-(trifluoromethyl)-1H-indazol-4-yl]imidazo[1,2-a]pyridin-2-yl]formamide |
| SMILES | Cc1c(F)c(C(F)(F)F)c2[nH]ncc2c1-c1ccc2nc(NC=O)cn2c1 |
| InChI | InChI=1S/C17H11F4N5O/c1-8-13(9-2-3-12-24-11(22-7-27)6-26(12)5-9)10-4-23-25-16(10)14(15(8)18)17(19,20)21/h2-7H,1H3,(H,22,27)(H,23,25) |
| InChIKey | KGHJQMDOOWPWAE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|