C18H15ClFN5O2 — CID 163221360
N-[6-[5-chloro-6-fluoro-7-(2-hydroxypropan-2-yl)-1H-indazol-4-yl]imidazo[1,2-a]pyridin-2-yl]formamide (PubChem CID 163221360) has the molecular formula C18H15ClFN5O2 and a molecular weight of 387.80 g/mol. Its IUPAC name is N-[6-[5-chloro-6-fluoro-7-(2-hydroxypropan-2-yl)-1H-indazol-4-yl]imidazo[1,2-a]pyridin-2-yl]formamide.
| Compound Name | N-[6-[5-chloro-6-fluoro-7-(2-hydroxypropan-2-yl)-1H-indazol-4-yl]imidazo[1,2-a]pyridin-2-yl]formamide |
|---|---|
| PubChem CID | 163221360 |
| Molecular Formula | C18H15ClFN5O2 |
| Molecular Weight | 387.80 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N-[6-[5-chloro-6-fluoro-7-(2-hydroxypropan-2-yl)-1H-indazol-4-yl]imidazo[1,2-a]pyridin-2-yl]formamide |
| SMILES | CC(C)(O)c1c(F)c(Cl)c(-c2ccc3nc(NC=O)cn3c2)c2cn[nH]c12 |
| InChI | InChI=1S/C18H15ClFN5O2/c1-18(2,27)14-16(20)15(19)13(10-5-22-24-17(10)14)9-3-4-12-23-11(21-8-26)7-25(12)6-9/h3-8,27H,1-2H3,(H,21,26)(H,22,24) |
| InChIKey | HVBATTLGCUKIBW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 95.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.80 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|