About 4-(1-ethoxypropa-1,2-dienyl)oxocane
4-(1-ethoxypropa-1,2-dienyl)oxocane (PubChem CID 163222819) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 4-(1-ethoxypropa-1,2-dienyl)oxocane.
Molecular Properties
| Compound Name | 4-(1-ethoxypropa-1,2-dienyl)oxocane |
| PubChem CID | 163222819 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 4-(1-ethoxypropa-1,2-dienyl)oxocane |
| SMILES | C=C=C(OCC)C1CCCCOCC1 |
| InChI | InChI=1S/C12H20O2/c1-3-12(14-4-2)11-7-5-6-9-13-10-8-11/h11H,1,4-10H2,2H3 |
| InChIKey | OYAOCXQIHRGUQN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-ethoxypropa-1,2-dienyl)oxocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-ethoxypropa-1,2-dienyl)oxocane?
The IUPAC name of 4-(1-ethoxypropa-1,2-dienyl)oxocane (CID 163222819) is 4-(1-ethoxypropa-1,2-dienyl)oxocane.
What is the SMILES notation for 4-(1-ethoxypropa-1,2-dienyl)oxocane?
The canonical SMILES for 4-(1-ethoxypropa-1,2-dienyl)oxocane is C=C=C(OCC)C1CCCCOCC1.
What is the InChIKey of 4-(1-ethoxypropa-1,2-dienyl)oxocane?
The InChIKey is OYAOCXQIHRGUQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-3-12(14-4-2)11-7-5-6-9-13-10-8-11/h11H,1,4-10H2,2H3.
What are the key properties of 4-(1-ethoxypropa-1,2-dienyl)oxocane?
4-(1-ethoxypropa-1,2-dienyl)oxocane has a molecular weight of 196.29 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-ethoxypropa-1,2-dienyl)oxocane is sourced from PubChem (CID 163222819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).