C24H40N6O — CID 163223192
4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine;propane (PubChem CID 163223192) has the molecular formula C24H40N6O and a molecular weight of 428.63 g/mol. Its IUPAC name is 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine;propane.
| Compound Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine;propane |
|---|---|
| PubChem CID | 163223192 |
| Molecular Formula | C24H40N6O |
| Molecular Weight | 428.63 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine;propane |
| SMILES | C1CN2CCCC2(COc2nc3c(c(N4CC5CCC(C4)N5)n2)CCNC3)C1.CCC |
| InChI | InChI=1S/C21H32N6O.C3H8/c1-6-21(7-2-10-27(21)9-1)14-28-20-24-18-11-22-8-5-17(18)19(25-20)26-12-15-3-4-16(13-26)23-15;1-3-2/h15-16,22-23H,1-14H2;3H2,1-2H3 |
| InChIKey | AZKNLNROOJWFQO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.63 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |