C28H34ClF3LiN5O-2 — CID 163222822
lithium;1-chloro-2-(trifluoromethyl)benzene-3-ide;3-[5-ethyl-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-methanidylpyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane (PubChem CID 163222822) has the molecular formula C28H34ClF3LiN5O-2 and a molecular weight of 556.00 g/mol. Its IUPAC name is lithium;1-chloro-2-(trifluoromethyl)benzene-3-ide;3-[5-ethyl-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-methanidylpyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | lithium;1-chloro-2-(trifluoromethyl)benzene-3-ide;3-[5-ethyl-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-methanidylpyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 163222822 |
| Molecular Formula | C28H34ClF3LiN5O-2 |
| Molecular Weight | 556.00 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | lithium;1-chloro-2-(trifluoromethyl)benzene-3-ide;3-[5-ethyl-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-methanidylpyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane |
| SMILES | FC(F)(F)c1[c-]cccc1Cl.[CH2-]Cc1c([CH2-])nc(OCC23CCCN2CCC3)nc1N1CC2CCC(C1)N2.[Li+] |
| InChI | InChI=1S/C21H31N5O.C7H3ClF3.Li/c1-3-18-15(2)22-20(27-14-21-8-4-10-26(21)11-5-9-21)24-19(18)25-12-16-6-7-17(13-25)23-16;8-6-4-2-1-3-5(6)7(9,10)11;/h16-17,23H,1-14H2;1-2,4H;/q-2;-1;+1 |
| InChIKey | FVDNWSVJTLQSAZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.00 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|