C31H40F2LiN5O-2 — CID 163222787
lithium;3-[5,6-di(ethyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane;3,3-difluoro-2,7-dihydro-1H-inden-7-ide (PubChem CID 163222787) has the molecular formula C31H40F2LiN5O-2 and a molecular weight of 543.63 g/mol. Its IUPAC name is lithium;3-[5,6-di(ethyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane;3,3-difluoro-2,7-dihydro-1H-inden-7-ide.
| Compound Name | lithium;3-[5,6-di(ethyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane;3,3-difluoro-2,7-dihydro-1H-inden-7-ide |
|---|---|
| PubChem CID | 163222787 |
| Molecular Formula | C31H40F2LiN5O-2 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.34 |
| IUPAC Name | lithium;3-[5,6-di(ethyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane;3,3-difluoro-2,7-dihydro-1H-inden-7-ide |
| SMILES | FC1(F)CCc2[c-]cccc21.[CH2-]Cc1nc(OCC23CCCN2CCC3)nc(N2CC3CCC(C2)N3)c1C[CH2-].[Li+] |
| InChI | InChI=1S/C22H33N5O.C9H7F2.Li/c1-3-18-19(4-2)24-21(28-15-22-9-5-11-27(22)12-6-10-22)25-20(18)26-13-16-7-8-17(14-26)23-16;10-9(11)6-5-7-3-1-2-4-8(7)9;/h16-17,23H,1-15H2;1-2,4H,5-6H2;/q-2;-1;+1 |
| InChIKey | CYCLNZUTIDACHM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|