C29H38FN6O2Pr- — CID 156645887
1-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-(fluoromethyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimidin-5-yl]-N-(1-phenylethenyl)methanimine;methanol;praseodymium (PubChem CID 156645887) has the molecular formula C29H38FN6O2Pr- and a molecular weight of 662.57 g/mol. Its IUPAC name is 1-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-(fluoromethyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimidin-5-yl]-N-(1-phenylethenyl)methanimine;methanol;praseodymium.
| Compound Name | 1-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-(fluoromethyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimidin-5-yl]-N-(1-phenylethenyl)methanimine;methanol;praseodymium |
|---|---|
| PubChem CID | 156645887 |
| Molecular Formula | C29H38FN6O2Pr- |
| Molecular Weight | 662.57 g/mol |
| Exact Mass | 662.21 |
| IUPAC Name | 1-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-(fluoromethyl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimidin-5-yl]-N-(1-phenylethenyl)methanimine;methanol;praseodymium |
| SMILES | C=C(/N=C/c1c(CF)nc(OCC23CCCN2CCC3)nc1N1CC2CCC(C1)N2)c1[c-]cccc1.CO.[Pr] |
| InChI | InChI=1S/C28H34FN6O.CH4O.Pr/c1-20(21-7-3-2-4-8-21)30-16-24-25(15-29)32-27(36-19-28-11-5-13-35(28)14-6-12-28)33-26(24)34-17-22-9-10-23(18-34)31-22;1-2;/h2-4,7,16,22-23,31H,1,5-6,9-15,17-19H2;2H,1H3;/q-1;;/b30-16+;; |
| InChIKey | QLNAGLAPHYQOJH-SUURIMAMSA-N |
| XLogP | 3.39 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|