C21H33N5O — CID 163222823
3-[5-ethyl-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-methylpyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane (PubChem CID 163222823) has the molecular formula C21H33N5O and a molecular weight of 371.53 g/mol. Its IUPAC name is 3-[5-ethyl-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-methylpyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | 3-[5-ethyl-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-methylpyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 163222823 |
| Molecular Formula | C21H33N5O |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.27 |
| IUPAC Name | 3-[5-ethyl-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-methylpyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CCc1c(C)nc(OCC23CCCN2CCC3)nc1N1CC2CCC(C1)N2 |
| InChI | InChI=1S/C21H33N5O/c1-3-18-15(2)22-20(27-14-21-8-4-10-26(21)11-5-9-21)24-19(18)25-12-16-6-7-17(13-25)23-16/h16-17,23H,3-14H2,1-2H3 |
| InChIKey | ZUAABSBOYWIJRZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |