C22H35N5O — CID 163222788
3-[5,6-diethyl-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane (PubChem CID 163222788) has the molecular formula C22H35N5O and a molecular weight of 385.56 g/mol. Its IUPAC name is 3-[5,6-diethyl-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | 3-[5,6-diethyl-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 163222788 |
| Molecular Formula | C22H35N5O |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | 3-[5,6-diethyl-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CCc1nc(OCC23CCCN2CCC3)nc(N2CC3CCC(C2)N3)c1CC |
| InChI | InChI=1S/C22H35N5O/c1-3-18-19(4-2)24-21(28-15-22-9-5-11-27(22)12-6-10-22)25-20(18)26-13-16-7-8-17(14-26)23-16/h16-17,23H,3-15H2,1-2H3 |
| InChIKey | MHMCPKJMYLCWDB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |