C23H38N6O — CID 163223539
4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine;ethane (PubChem CID 163223539) has the molecular formula C23H38N6O and a molecular weight of 414.60 g/mol. Its IUPAC name is 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine;ethane.
| Compound Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine;ethane |
|---|---|
| PubChem CID | 163223539 |
| Molecular Formula | C23H38N6O |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine;ethane |
| SMILES | C1CN2CCCC2(COc2nc3c(c(N4CC5CCC(C4)N5)n2)CCNC3)C1.CC |
| InChI | InChI=1S/C21H32N6O.C2H6/c1-6-21(7-2-10-27(21)9-1)14-28-20-24-18-11-22-8-5-17(18)19(25-20)26-12-15-3-4-16(13-26)23-15;1-2/h15-16,22-23H,1-14H2;1-2H3 |
| InChIKey | LCSVXXLQQCZFFD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |