C25H24ClF3N4O3S — CID 163227184
1-[(3S)-4-[7-chloro-8-[5-(difluoromethoxy)-2-fluorophenyl]-2-hydroxy-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 163227184) has the molecular formula C25H24ClF3N4O3S and a molecular weight of 553.01 g/mol. Its IUPAC name is 1-[(3S)-4-[7-chloro-8-[5-(difluoromethoxy)-2-fluorophenyl]-2-hydroxy-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S)-4-[7-chloro-8-[5-(difluoromethoxy)-2-fluorophenyl]-2-hydroxy-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 163227184 |
| Molecular Formula | C25H24ClF3N4O3S |
| Molecular Weight | 553.01 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | 1-[(3S)-4-[7-chloro-8-[5-(difluoromethoxy)-2-fluorophenyl]-2-hydroxy-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C2=NC(O)N3CCSc4c(-c5cc(OC(F)F)ccc5F)c(Cl)cc2c43)[C@@H](C)C1 |
| InChI | InChI=1S/C25H24ClF3N4O3S/c1-3-19(34)31-6-7-32(13(2)12-31)23-16-11-17(26)20(15-10-14(36-24(28)29)4-5-18(15)27)22-21(16)33(8-9-37-22)25(35)30-23/h3-5,10-11,13,24-25,35H,1,6-9,12H2,2H3/t13-,25?/m0/s1 |
| InChIKey | MLYJJBDECKVLRY-GLLGCSJKSA-N |
| XLogP | 4.41 |
| TPSA | 68.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.01 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|