C10H14N2 — CID 163229020
3-(1-aminoethenyl)-N,N-dimethylaniline (PubChem CID 163229020) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 3-(1-aminoethenyl)-N,N-dimethylaniline.
| Compound Name | 3-(1-aminoethenyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 163229020 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 3-(1-aminoethenyl)-N,N-dimethylaniline |
| SMILES | C=C(N)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C10H14N2/c1-8(11)9-5-4-6-10(7-9)12(2)3/h4-7H,1,11H2,2-3H3 |
| InChIKey | KIBXODUYNGDECK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |