C22H21F3N8O2 — CID 163229551
3-methyl-4-oxo-N-[(1R,3S)-3-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide (PubChem CID 163229551) has the molecular formula C22H21F3N8O2 and a molecular weight of 486.46 g/mol. Its IUPAC name is 3-methyl-4-oxo-N-[(1R,3S)-3-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide.
| Compound Name | 3-methyl-4-oxo-N-[(1R,3S)-3-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
|---|---|
| PubChem CID | 163229551 |
| Molecular Formula | C22H21F3N8O2 |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 3-methyl-4-oxo-N-[(1R,3S)-3-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
| SMILES | Cn1nnc2c(C(=O)N[C@@H]3CCC[C@H](Nc4cc(C(F)(F)F)nc5ccccc45)C3)ncn2c1=O |
| InChI | InChI=1S/C22H21F3N8O2/c1-32-21(35)33-11-26-18(19(33)30-31-32)20(34)28-13-6-4-5-12(9-13)27-16-10-17(22(23,24)25)29-15-8-3-2-7-14(15)16/h2-3,7-8,10-13H,4-6,9H2,1H3,(H,27,29)(H,28,34)/t12-,13+/m0/s1 |
| InChIKey | ABZSWIJEUBUXFH-QWHCGFSZSA-N |
| XLogP | 2.54 |
| TPSA | 119.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |