C26H26F3N3O — CID 163228978
2-benzyl-N-[(1R,3S)-3-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]prop-2-enamide (PubChem CID 163228978) has the molecular formula C26H26F3N3O and a molecular weight of 453.51 g/mol. Its IUPAC name is 2-benzyl-N-[(1R,3S)-3-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]prop-2-enamide.
| Compound Name | 2-benzyl-N-[(1R,3S)-3-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 163228978 |
| Molecular Formula | C26H26F3N3O |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 2-benzyl-N-[(1R,3S)-3-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]prop-2-enamide |
| SMILES | C=C(Cc1ccccc1)C(=O)N[C@@H]1CCC[C@H](Nc2cc(C(F)(F)F)nc3ccccc23)C1 |
| InChI | InChI=1S/C26H26F3N3O/c1-17(14-18-8-3-2-4-9-18)25(33)31-20-11-7-10-19(15-20)30-23-16-24(26(27,28)29)32-22-13-6-5-12-21(22)23/h2-6,8-9,12-13,16,19-20H,1,7,10-11,14-15H2,(H,30,32)(H,31,33)/t19-,20+/m0/s1 |
| InChIKey | DOOZQDJKMSDTGI-VQTJNVASSA-N |
| XLogP | 5.89 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|