C24H22ClF3N4O — CID 163228924
N-[(1R,3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-imino-2-phenylacetamide (PubChem CID 163228924) has the molecular formula C24H22ClF3N4O and a molecular weight of 474.91 g/mol. Its IUPAC name is N-[(1R,3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-imino-2-phenylacetamide.
| Compound Name | N-[(1R,3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-imino-2-phenylacetamide |
|---|---|
| PubChem CID | 163228924 |
| Molecular Formula | C24H22ClF3N4O |
| Molecular Weight | 474.91 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | N-[(1R,3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-imino-2-phenylacetamide |
| SMILES | [H]/N=C(/C(=O)N[C@@H]1CCC[C@H](Nc2cc(C(F)(F)F)nc3ccc(Cl)cc23)C1)c1ccccc1 |
| InChI | InChI=1S/C24H22ClF3N4O/c25-15-9-10-19-18(11-15)20(13-21(32-19)24(26,27)28)30-16-7-4-8-17(12-16)31-23(33)22(29)14-5-2-1-3-6-14/h1-3,5-6,9-11,13,16-17,29H,4,7-8,12H2,(H,30,32)(H,31,33)/b29-22+/t16-,17+/m0/s1 |
| InChIKey | JTBSWZKKLJXADS-MQHTTYMBSA-N |
| XLogP | 5.81 |
| TPSA | 77.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.91 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|