C21H19ClF3N6O+ — CID 170941455
N-[(1R,3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-cyano-1H-pyrazol-2-ium-4-carboxamide (PubChem CID 170941455) has the molecular formula C21H19ClF3N6O+ and a molecular weight of 463.87 g/mol. Its IUPAC name is N-[(1R,3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-cyano-1H-pyrazol-2-ium-4-carboxamide.
| Compound Name | N-[(1R,3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-cyano-1H-pyrazol-2-ium-4-carboxamide |
|---|---|
| PubChem CID | 170941455 |
| Molecular Formula | C21H19ClF3N6O+ |
| Molecular Weight | 463.87 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | N-[(1R,3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-cyano-1H-pyrazol-2-ium-4-carboxamide |
| SMILES | N#C[n+]1cc(C(=O)N[C@@H]2CCC[C@H](Nc3cc(C(F)(F)F)nc4ccc(Cl)cc34)C2)c[nH]1 |
| InChI | InChI=1S/C21H18ClF3N6O/c22-13-4-5-17-16(6-13)18(8-19(30-17)21(23,24)25)28-14-2-1-3-15(7-14)29-20(32)12-9-27-31(10-12)11-26/h4-6,8-10,14-15H,1-3,7H2,(H2,28,29,30,32)/p+1/t14-,15+/m0/s1 |
| InChIKey | CALZAAXYRGKQFO-LSDHHAIUSA-O |
| XLogP | 4.00 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.87 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|