C22H21ClF3N5O2 — CID 164787039
N-[4-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-5-methyl-4-oxidopyrazin-4-ium-2-carboxamide (PubChem CID 164787039) has the molecular formula C22H21ClF3N5O2 and a molecular weight of 479.89 g/mol. Its IUPAC name is N-[4-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-5-methyl-4-oxidopyrazin-4-ium-2-carboxamide.
| Compound Name | N-[4-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-5-methyl-4-oxidopyrazin-4-ium-2-carboxamide |
|---|---|
| PubChem CID | 164787039 |
| Molecular Formula | C22H21ClF3N5O2 |
| Molecular Weight | 479.89 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | N-[4-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-5-methyl-4-oxidopyrazin-4-ium-2-carboxamide |
| SMILES | Cc1cnc(C(=O)NC2CCC(Nc3cc(C(F)(F)F)nc4ccc(Cl)cc34)CC2)c[n+]1[O-] |
| InChI | InChI=1S/C22H21ClF3N5O2/c1-12-10-27-19(11-31(12)33)21(32)29-15-5-3-14(4-6-15)28-18-9-20(22(24,25)26)30-17-7-2-13(23)8-16(17)18/h2,7-11,14-15H,3-6H2,1H3,(H,28,30)(H,29,32) |
| InChIKey | UTYVIHPSFWLVNJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 93.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.89 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|