C16H18F3N3 — CID 175434661
(1R)-1-N-[2-(trifluoromethyl)quinolin-4-yl]cyclohexane-1,3-diamine (PubChem CID 175434661) has the molecular formula C16H18F3N3 and a molecular weight of 309.33 g/mol. Its IUPAC name is (1R)-1-N-[2-(trifluoromethyl)quinolin-4-yl]cyclohexane-1,3-diamine.
| Compound Name | (1R)-1-N-[2-(trifluoromethyl)quinolin-4-yl]cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 175434661 |
| Molecular Formula | C16H18F3N3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (1R)-1-N-[2-(trifluoromethyl)quinolin-4-yl]cyclohexane-1,3-diamine |
| SMILES | NC1CCC[C@@H](Nc2cc(C(F)(F)F)nc3ccccc23)C1 |
| InChI | InChI=1S/C16H18F3N3/c17-16(18,19)15-9-14(12-6-1-2-7-13(12)22-15)21-11-5-3-4-10(20)8-11/h1-2,6-7,9-11H,3-5,8,20H2,(H,21,22)/t10?,11-/m1/s1 |
| InChIKey | GHVNXDWVWBUFEC-RRKGBCIJSA-N |
| XLogP | 3.94 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |