C20H18F3N5OS — CID 163228919
N-[[(3S)-3-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]methylidene]thiadiazole-4-carboxamide (PubChem CID 163228919) has the molecular formula C20H18F3N5OS and a molecular weight of 433.46 g/mol. Its IUPAC name is N-[[(3S)-3-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]methylidene]thiadiazole-4-carboxamide.
| Compound Name | N-[[(3S)-3-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]methylidene]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 163228919 |
| Molecular Formula | C20H18F3N5OS |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-[[(3S)-3-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]methylidene]thiadiazole-4-carboxamide |
| SMILES | O=C(/N=C/C1CCC[C@H](Nc2cc(C(F)(F)F)nc3ccccc23)C1)c1csnn1 |
| InChI | InChI=1S/C20H18F3N5OS/c21-20(22,23)18-9-16(14-6-1-2-7-15(14)26-18)25-13-5-3-4-12(8-13)10-24-19(29)17-11-30-28-27-17/h1-2,6-7,9-13H,3-5,8H2,(H,25,26)/b24-10+/t12?,13-/m0/s1 |
| InChIKey | JZKKOEVWMXUPIK-OYNRPVRMSA-N |
| XLogP | 4.99 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|