C20H13ClFN3O2 — CID 163233891
3-chloro-4-[1-(4-fluoro-3-hydroxyphenyl)indazol-5-yl]benzamide (PubChem CID 163233891) has the molecular formula C20H13ClFN3O2 and a molecular weight of 381.79 g/mol. Its IUPAC name is 3-chloro-4-[1-(4-fluoro-3-hydroxyphenyl)indazol-5-yl]benzamide.
| Compound Name | 3-chloro-4-[1-(4-fluoro-3-hydroxyphenyl)indazol-5-yl]benzamide |
|---|---|
| PubChem CID | 163233891 |
| Molecular Formula | C20H13ClFN3O2 |
| Molecular Weight | 381.79 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 3-chloro-4-[1-(4-fluoro-3-hydroxyphenyl)indazol-5-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2ccc3c(cnn3-c3ccc(F)c(O)c3)c2)c(Cl)c1 |
| InChI | InChI=1S/C20H13ClFN3O2/c21-16-8-12(20(23)27)1-4-15(16)11-2-6-18-13(7-11)10-24-25(18)14-3-5-17(22)19(26)9-14/h1-10,26H,(H2,23,27) |
| InChIKey | JDTFVLDOCOAACG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.79 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |