C16H29N3O2 — CID 163235694
tert-butyl N-[2-(2-cyclopropyl-4-methylimidazol-1-yl)ethyl]carbamate;ethane (PubChem CID 163235694) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is tert-butyl N-[2-(2-cyclopropyl-4-methylimidazol-1-yl)ethyl]carbamate;ethane.
| Compound Name | tert-butyl N-[2-(2-cyclopropyl-4-methylimidazol-1-yl)ethyl]carbamate;ethane |
|---|---|
| PubChem CID | 163235694 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | tert-butyl N-[2-(2-cyclopropyl-4-methylimidazol-1-yl)ethyl]carbamate;ethane |
| SMILES | CC.Cc1cn(CCNC(=O)OC(C)(C)C)c(C2CC2)n1 |
| InChI | InChI=1S/C14H23N3O2.C2H6/c1-10-9-17(12(16-10)11-5-6-11)8-7-15-13(18)19-14(2,3)4;1-2/h9,11H,5-8H2,1-4H3,(H,15,18);1-2H3 |
| InChIKey | YTVUYWAJHFMXGC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |