C38H41FN2O10 — CID 163236794
tert-butyl 3-fluoropyrrolidine-1-carboxylate;tert-butyl 2-[5-(2-formyl-1,3-dioxoinden-5-yl)-1,3-dioxoindene-2-carbonyl]pyrrolidine-1-carboxylate (PubChem CID 163236794) has the molecular formula C38H41FN2O10 and a molecular weight of 704.75 g/mol. Its IUPAC name is tert-butyl 3-fluoropyrrolidine-1-carboxylate;tert-butyl 2-[5-(2-formyl-1,3-dioxoinden-5-yl)-1,3-dioxoindene-2-carbonyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-fluoropyrrolidine-1-carboxylate;tert-butyl 2-[5-(2-formyl-1,3-dioxoinden-5-yl)-1,3-dioxoindene-2-carbonyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 163236794 |
| Molecular Formula | C38H41FN2O10 |
| Molecular Weight | 704.75 g/mol |
| Exact Mass | 704.27 |
| IUPAC Name | tert-butyl 3-fluoropyrrolidine-1-carboxylate;tert-butyl 2-[5-(2-formyl-1,3-dioxoinden-5-yl)-1,3-dioxoindene-2-carbonyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)C1.CC(C)(C)OC(=O)N1CCCC1C(=O)C1C(=O)c2ccc(-c3ccc4c(c3)C(=O)C(C=O)C4=O)cc2C1=O |
| InChI | InChI=1S/C29H25NO8.C9H16FNO2/c1-29(2,3)38-28(37)30-10-4-5-21(30)27(36)22-25(34)17-9-7-15(12-19(17)26(22)35)14-6-8-16-18(11-14)24(33)20(13-31)23(16)32;1-9(2,3)13-8(12)11-5-4-7(10)6-11/h6-9,11-13,20-22H,4-5,10H2,1-3H3;7H,4-6H2,1-3H3 |
| InChIKey | ZBDYXZSWEQAVSM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 161.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.75 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|