C13H15BrN2O3 — CID 163237778
cyclobutyl 6-(2-bromopropanoylamino)pyridine-3-carboxylate (PubChem CID 163237778) has the molecular formula C13H15BrN2O3 and a molecular weight of 327.18 g/mol. Its IUPAC name is cyclobutyl 6-(2-bromopropanoylamino)pyridine-3-carboxylate.
| Compound Name | cyclobutyl 6-(2-bromopropanoylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 163237778 |
| Molecular Formula | C13H15BrN2O3 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | cyclobutyl 6-(2-bromopropanoylamino)pyridine-3-carboxylate |
| SMILES | CC(Br)C(=O)Nc1ccc(C(=O)OC2CCC2)cn1 |
| InChI | InChI=1S/C13H15BrN2O3/c1-8(14)12(17)16-11-6-5-9(7-15-11)13(18)19-10-3-2-4-10/h5-8,10H,2-4H2,1H3,(H,15,16,17) |
| InChIKey | FNJAKVQVTXPTIR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|