C14H11BrF2N2O2 — CID 163237982
(2R)-2-bromo-N-[5-(2,4-difluorophenoxy)-2-pyridinyl]propanamide (PubChem CID 163237982) has the molecular formula C14H11BrF2N2O2 and a molecular weight of 357.15 g/mol. Its IUPAC name is (2R)-2-bromo-N-[5-(2,4-difluorophenoxy)-2-pyridinyl]propanamide.
| Compound Name | (2R)-2-bromo-N-[5-(2,4-difluorophenoxy)-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 163237982 |
| Molecular Formula | C14H11BrF2N2O2 |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | (2R)-2-bromo-N-[5-(2,4-difluorophenoxy)-2-pyridinyl]propanamide |
| SMILES | C[C@@H](Br)C(=O)Nc1ccc(Oc2ccc(F)cc2F)cn1 |
| InChI | InChI=1S/C14H11BrF2N2O2/c1-8(15)14(20)19-13-5-3-10(7-18-13)21-12-4-2-9(16)6-11(12)17/h2-8H,1H3,(H,18,19,20)/t8-/m1/s1 |
| InChIKey | JIEMKFVKRSYAIX-MRVPVSSYSA-N |
| XLogP | 3.87 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|