C24H23F2N5O5 — CID 175724284
4-[4-[1-[[5-(2,4-difluorophenoxy)-2-pyridinyl]amino]-1-oxopropan-2-yl]morpholin-2-yl]-1-oxidopyridin-1-ium-2-carboxamide (PubChem CID 175724284) has the molecular formula C24H23F2N5O5 and a molecular weight of 499.47 g/mol. Its IUPAC name is 4-[4-[1-[[5-(2,4-difluorophenoxy)-2-pyridinyl]amino]-1-oxopropan-2-yl]morpholin-2-yl]-1-oxidopyridin-1-ium-2-carboxamide.
| Compound Name | 4-[4-[1-[[5-(2,4-difluorophenoxy)-2-pyridinyl]amino]-1-oxopropan-2-yl]morpholin-2-yl]-1-oxidopyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 175724284 |
| Molecular Formula | C24H23F2N5O5 |
| Molecular Weight | 499.47 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 4-[4-[1-[[5-(2,4-difluorophenoxy)-2-pyridinyl]amino]-1-oxopropan-2-yl]morpholin-2-yl]-1-oxidopyridin-1-ium-2-carboxamide |
| SMILES | CC(C(=O)Nc1ccc(Oc2ccc(F)cc2F)cn1)N1CCOC(c2cc[n+]([O-])c(C(N)=O)c2)C1 |
| InChI | InChI=1S/C24H23F2N5O5/c1-14(30-8-9-35-21(13-30)15-6-7-31(34)19(10-15)23(27)32)24(33)29-22-5-3-17(12-28-22)36-20-4-2-16(25)11-18(20)26/h2-7,10-12,14,21H,8-9,13H2,1H3,(H2,27,32)(H,28,29,33) |
| InChIKey | QLUFLLJURGFXBE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 133.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|