C24H21F5N4O2 — CID 174231180
(2S)-2-[(3S)-4,4-difluoro-3-pyridin-4-ylpiperidin-1-yl]-N-[5-(2,4,5-trifluorophenoxy)-2-pyridinyl]propanamide (PubChem CID 174231180) has the molecular formula C24H21F5N4O2 and a molecular weight of 492.45 g/mol. Its IUPAC name is (2S)-2-[(3S)-4,4-difluoro-3-pyridin-4-ylpiperidin-1-yl]-N-[5-(2,4,5-trifluorophenoxy)-2-pyridinyl]propanamide.
| Compound Name | (2S)-2-[(3S)-4,4-difluoro-3-pyridin-4-ylpiperidin-1-yl]-N-[5-(2,4,5-trifluorophenoxy)-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 174231180 |
| Molecular Formula | C24H21F5N4O2 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | (2S)-2-[(3S)-4,4-difluoro-3-pyridin-4-ylpiperidin-1-yl]-N-[5-(2,4,5-trifluorophenoxy)-2-pyridinyl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(Oc2cc(F)c(F)cc2F)cn1)N1CCC(F)(F)[C@@H](c2ccncc2)C1 |
| InChI | InChI=1S/C24H21F5N4O2/c1-14(33-9-6-24(28,29)17(13-33)15-4-7-30-8-5-15)23(34)32-22-3-2-16(12-31-22)35-21-11-19(26)18(25)10-20(21)27/h2-5,7-8,10-12,14,17H,6,9,13H2,1H3,(H,31,32,34)/t14-,17+/m0/s1 |
| InChIKey | QFLKLSRQSDGPPN-WMLDXEAASA-N |
| XLogP | 5.14 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|