C25H25F3N4O4 — CID 174231012
2-[4,4-difluoro-3-[2-(hydroxymethyl)-1-oxidopyridin-1-ium-4-yl]piperidin-1-yl]-N-[5-(4-fluorophenoxy)-2-pyridinyl]propanamide (PubChem CID 174231012) has the molecular formula C25H25F3N4O4 and a molecular weight of 502.49 g/mol. Its IUPAC name is 2-[4,4-difluoro-3-[2-(hydroxymethyl)-1-oxidopyridin-1-ium-4-yl]piperidin-1-yl]-N-[5-(4-fluorophenoxy)-2-pyridinyl]propanamide.
| Compound Name | 2-[4,4-difluoro-3-[2-(hydroxymethyl)-1-oxidopyridin-1-ium-4-yl]piperidin-1-yl]-N-[5-(4-fluorophenoxy)-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 174231012 |
| Molecular Formula | C25H25F3N4O4 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 2-[4,4-difluoro-3-[2-(hydroxymethyl)-1-oxidopyridin-1-ium-4-yl]piperidin-1-yl]-N-[5-(4-fluorophenoxy)-2-pyridinyl]propanamide |
| SMILES | CC(C(=O)Nc1ccc(Oc2ccc(F)cc2)cn1)N1CCC(F)(F)C(c2cc[n+]([O-])c(CO)c2)C1 |
| InChI | InChI=1S/C25H25F3N4O4/c1-16(24(34)30-23-7-6-21(13-29-23)36-20-4-2-18(26)3-5-20)31-11-9-25(27,28)22(14-31)17-8-10-32(35)19(12-17)15-33/h2-8,10,12-13,16,22,33H,9,11,14-15H2,1H3,(H,29,30,34) |
| InChIKey | ISFLXBRQVHEKMA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|