C29H33F3N4O4 — CID 164958147
2-[4,4-difluoro-3-[5-(4-methoxybutyl)-6-oxo-1H-pyridin-3-yl]piperidin-1-yl]-N-[5-(4-fluorophenoxy)-2-pyridinyl]propanamide (PubChem CID 164958147) has the molecular formula C29H33F3N4O4 and a molecular weight of 558.60 g/mol. Its IUPAC name is 2-[4,4-difluoro-3-[5-(4-methoxybutyl)-6-oxo-1H-pyridin-3-yl]piperidin-1-yl]-N-[5-(4-fluorophenoxy)-2-pyridinyl]propanamide.
| Compound Name | 2-[4,4-difluoro-3-[5-(4-methoxybutyl)-6-oxo-1H-pyridin-3-yl]piperidin-1-yl]-N-[5-(4-fluorophenoxy)-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 164958147 |
| Molecular Formula | C29H33F3N4O4 |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | 2-[4,4-difluoro-3-[5-(4-methoxybutyl)-6-oxo-1H-pyridin-3-yl]piperidin-1-yl]-N-[5-(4-fluorophenoxy)-2-pyridinyl]propanamide |
| SMILES | COCCCCc1cc(C2CN(C(C)C(=O)Nc3ccc(Oc4ccc(F)cc4)cn3)CCC2(F)F)c[nH]c1=O |
| InChI | InChI=1S/C29H33F3N4O4/c1-19(27(37)35-26-11-10-24(17-33-26)40-23-8-6-22(30)7-9-23)36-13-12-29(31,32)25(18-36)21-15-20(28(38)34-16-21)5-3-4-14-39-2/h6-11,15-17,19,25H,3-5,12-14,18H2,1-2H3,(H,34,38)(H,33,35,37) |
| InChIKey | BLKFVDKNPORNAR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|