C22H24F3N3O2 — CID 163238267
2-(4,4-difluoro-3-prop-1-en-2-ylpiperidin-1-yl)-N-[5-(4-fluorophenoxy)-2-pyridinyl]propanamide (PubChem CID 163238267) has the molecular formula C22H24F3N3O2 and a molecular weight of 419.45 g/mol. Its IUPAC name is 2-(4,4-difluoro-3-prop-1-en-2-ylpiperidin-1-yl)-N-[5-(4-fluorophenoxy)-2-pyridinyl]propanamide.
| Compound Name | 2-(4,4-difluoro-3-prop-1-en-2-ylpiperidin-1-yl)-N-[5-(4-fluorophenoxy)-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 163238267 |
| Molecular Formula | C22H24F3N3O2 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-(4,4-difluoro-3-prop-1-en-2-ylpiperidin-1-yl)-N-[5-(4-fluorophenoxy)-2-pyridinyl]propanamide |
| SMILES | C=C(C)C1CN(C(C)C(=O)Nc2ccc(Oc3ccc(F)cc3)cn2)CCC1(F)F |
| InChI | InChI=1S/C22H24F3N3O2/c1-14(2)19-13-28(11-10-22(19,24)25)15(3)21(29)27-20-9-8-18(12-26-20)30-17-6-4-16(23)5-7-17/h4-9,12,15,19H,1,10-11,13H2,2-3H3,(H,26,27,29) |
| InChIKey | LNVZPJDOSDGIFH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|